C21H30ClNO — CID 54022593
1-chloro-N-[1-(2,4-dimethylphenyl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalene-1-carboxamide (PubChem CID 54022593) has the molecular formula C21H30ClNO and a molecular weight of 347.93 g/mol. Its IUPAC name is 1-chloro-N-[1-(2,4-dimethylphenyl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalene-1-carboxamide.
| Compound Name | 1-chloro-N-[1-(2,4-dimethylphenyl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 54022593 |
| Molecular Formula | C21H30ClNO |
| Molecular Weight | 347.93 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 1-chloro-N-[1-(2,4-dimethylphenyl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalene-1-carboxamide |
| SMILES | Cc1ccc(C(C)NC(=O)C2(Cl)CCCC3CCCCC32)c(C)c1 |
| InChI | InChI=1S/C21H30ClNO/c1-14-10-11-18(15(2)13-14)16(3)23-20(24)21(22)12-6-8-17-7-4-5-9-19(17)21/h10-11,13,16-17,19H,4-9,12H2,1-3H3,(H,23,24) |
| InChIKey | KZYLBCFPUACWED-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.93 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|