C16H21NO4S2 — CID 54022670
(4S)-5,5-dimethyl-3-[(2S)-2-(7-oxabicyclo[4.1.0]hepta-2,4-dien-2-ylmethyl)-3-sulfanylpropanoyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 54022670) has the molecular formula C16H21NO4S2 and a molecular weight of 355.48 g/mol. Its IUPAC name is (4S)-5,5-dimethyl-3-[(2S)-2-(7-oxabicyclo[4.1.0]hepta-2,4-dien-2-ylmethyl)-3-sulfanylpropanoyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4S)-5,5-dimethyl-3-[(2S)-2-(7-oxabicyclo[4.1.0]hepta-2,4-dien-2-ylmethyl)-3-sulfanylpropanoyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 54022670 |
| Molecular Formula | C16H21NO4S2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | (4S)-5,5-dimethyl-3-[(2S)-2-(7-oxabicyclo[4.1.0]hepta-2,4-dien-2-ylmethyl)-3-sulfanylpropanoyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC1(C)SCN(C(=O)[C@@H](CS)CC2=CC=CC3OC23)[C@H]1C(=O)O |
| InChI | InChI=1S/C16H21NO4S2/c1-16(2)13(15(19)20)17(8-23-16)14(18)10(7-22)6-9-4-3-5-11-12(9)21-11/h3-5,10-13,22H,6-8H2,1-2H3,(H,19,20)/t10-,11?,12?,13+/m1/s1 |
| InChIKey | KZZRKAGYIHAIGR-XVSSEFHLSA-N |
| XLogP | 1.95 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|