C13H24OS — CID 54022884
(2S)-1-(2,5-dimethylthian-3-yl)hex-5-en-2-ol (PubChem CID 54022884) has the molecular formula C13H24OS and a molecular weight of 228.40 g/mol. Its IUPAC name is (2S)-1-(2,5-dimethylthian-3-yl)hex-5-en-2-ol.
| Compound Name | (2S)-1-(2,5-dimethylthian-3-yl)hex-5-en-2-ol |
|---|---|
| PubChem CID | 54022884 |
| Molecular Formula | C13H24OS |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (2S)-1-(2,5-dimethylthian-3-yl)hex-5-en-2-ol |
| SMILES | C=CCC[C@H](O)CC1CC(C)CSC1C |
| InChI | InChI=1S/C13H24OS/c1-4-5-6-13(14)8-12-7-10(2)9-15-11(12)3/h4,10-14H,1,5-9H2,2-3H3/t10?,11?,12?,13-/m0/s1 |
| InChIKey | LADUYIOAAYMFII-SKQCGHHBSA-N |
| XLogP | 3.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|