C12H20O6 — CID 54023025
4-(oxiran-2-yl)-2,3-bis(oxiran-2-ylmethyl)butane-1,2,3-triol (PubChem CID 54023025) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-(oxiran-2-yl)-2,3-bis(oxiran-2-ylmethyl)butane-1,2,3-triol.
| Compound Name | 4-(oxiran-2-yl)-2,3-bis(oxiran-2-ylmethyl)butane-1,2,3-triol |
|---|---|
| PubChem CID | 54023025 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 4-(oxiran-2-yl)-2,3-bis(oxiran-2-ylmethyl)butane-1,2,3-triol |
| SMILES | OCC(O)(CC1CO1)C(O)(CC1CO1)CC1CO1 |
| InChI | InChI=1S/C12H20O6/c13-7-12(15,3-10-6-18-10)11(14,1-8-4-16-8)2-9-5-17-9/h8-10,13-15H,1-7H2 |
| InChIKey | LAGCFTBNHVNOIJ-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|