About 3-iminocyclopropane-1,2-diamine
3-iminocyclopropane-1,2-diamine (PubChem CID 54023414) has the molecular formula C3H7N3
and a molecular weight of 85.11 g/mol. Its IUPAC name is 3-iminocyclopropane-1,2-diamine.
Molecular Properties
| Compound Name | 3-iminocyclopropane-1,2-diamine |
| PubChem CID | 54023414 |
| Molecular Formula | C3H7N3 |
| Molecular Weight | 85.11 g/mol |
| Exact Mass | 85.06 |
| IUPAC Name | 3-iminocyclopropane-1,2-diamine |
| SMILES | [H]N=C1C(N)C1N |
| InChI | InChI=1S/C3H7N3/c4-1-2(5)3(1)6/h1-2,6H,4-5H2 |
| InChIKey | RJPYAWKDFXUTJX-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.11 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-iminocyclopropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iminocyclopropane-1,2-diamine?
The IUPAC name of 3-iminocyclopropane-1,2-diamine (CID 54023414) is 3-iminocyclopropane-1,2-diamine.
What is the SMILES notation for 3-iminocyclopropane-1,2-diamine?
The canonical SMILES for 3-iminocyclopropane-1,2-diamine is [H]N=C1C(N)C1N.
What is the InChIKey of 3-iminocyclopropane-1,2-diamine?
The InChIKey is RJPYAWKDFXUTJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N3/c4-1-2(5)3(1)6/h1-2,6H,4-5H2.
What are the key properties of 3-iminocyclopropane-1,2-diamine?
3-iminocyclopropane-1,2-diamine has a molecular weight of 85.11 g/mol, XLogP of -1.33, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iminocyclopropane-1,2-diamine is sourced from PubChem (CID 54023414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).