About 4-prop-2-enyl-3,4-dihydro-1H-quinazolin-2-one
4-prop-2-enyl-3,4-dihydro-1H-quinazolin-2-one (PubChem CID 54023611) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-prop-2-enyl-3,4-dihydro-1H-quinazolin-2-one.
Molecular Properties
| Compound Name | 4-prop-2-enyl-3,4-dihydro-1H-quinazolin-2-one |
| PubChem CID | 54023611 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 4-prop-2-enyl-3,4-dihydro-1H-quinazolin-2-one |
| SMILES | C=CCC1NC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C11H12N2O/c1-2-5-9-8-6-3-4-7-10(8)13-11(14)12-9/h2-4,6-7,9H,1,5H2,(H2,12,13,14) |
| InChIKey | LAPXIOJGODXLLZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-2-enyl-3,4-dihydro-1H-quinazolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-2-enyl-3,4-dihydro-1H-quinazolin-2-one?
The IUPAC name of 4-prop-2-enyl-3,4-dihydro-1H-quinazolin-2-one (CID 54023611) is 4-prop-2-enyl-3,4-dihydro-1H-quinazolin-2-one.
What is the SMILES notation for 4-prop-2-enyl-3,4-dihydro-1H-quinazolin-2-one?
The canonical SMILES for 4-prop-2-enyl-3,4-dihydro-1H-quinazolin-2-one is C=CCC1NC(=O)Nc2ccccc21.
What is the InChIKey of 4-prop-2-enyl-3,4-dihydro-1H-quinazolin-2-one?
The InChIKey is LAPXIOJGODXLLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O/c1-2-5-9-8-6-3-4-7-10(8)13-11(14)12-9/h2-4,6-7,9H,1,5H2,(H2,12,13,14).
What are the key properties of 4-prop-2-enyl-3,4-dihydro-1H-quinazolin-2-one?
4-prop-2-enyl-3,4-dihydro-1H-quinazolin-2-one has a molecular weight of 188.23 g/mol, XLogP of 2.44, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-2-enyl-3,4-dihydro-1H-quinazolin-2-one is sourced from PubChem (CID 54023611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).