C38H44O5 — CID 54023618
2-[1-(2-hydroxy-3,5-dimethylphenyl)ethyl]-4,6-dimethylphenol;[2-[(2-hydroxy-3,5-dimethylphenyl)methyl]-4,6-dimethylphenyl] prop-2-enoate (PubChem CID 54023618) has the molecular formula C38H44O5 and a molecular weight of 580.77 g/mol. Its IUPAC name is 2-[1-(2-hydroxy-3,5-dimethylphenyl)ethyl]-4,6-dimethylphenol;[2-[(2-hydroxy-3,5-dimethylphenyl)methyl]-4,6-dimethylphenyl] prop-2-enoate.
| Compound Name | 2-[1-(2-hydroxy-3,5-dimethylphenyl)ethyl]-4,6-dimethylphenol;[2-[(2-hydroxy-3,5-dimethylphenyl)methyl]-4,6-dimethylphenyl] prop-2-enoate |
|---|---|
| PubChem CID | 54023618 |
| Molecular Formula | C38H44O5 |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | 2-[1-(2-hydroxy-3,5-dimethylphenyl)ethyl]-4,6-dimethylphenol;[2-[(2-hydroxy-3,5-dimethylphenyl)methyl]-4,6-dimethylphenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(C)cc(C)cc1Cc1cc(C)cc(C)c1O.Cc1cc(C)c(O)c(C(C)c2cc(C)cc(C)c2O)c1 |
| InChI | InChI=1S/C20H22O3.C18H22O2/c1-6-18(21)23-20-15(5)8-13(3)10-17(20)11-16-9-12(2)7-14(4)19(16)22;1-10-6-12(3)17(19)15(8-10)14(5)16-9-11(2)7-13(4)18(16)20/h6-10,22H,1,11H2,2-5H3;6-9,14,19-20H,1-5H3 |
| InChIKey | LAPZRYKOXZBFQN-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|