C17H45N9O — CID 54023673
N,N-dimethylmethanamine;1-ethyl-1,3,3-trimethylurea;bis(1,2,3-trimethylguanidine) (PubChem CID 54023673) has the molecular formula C17H45N9O and a molecular weight of 391.61 g/mol. Its IUPAC name is N,N-dimethylmethanamine;1-ethyl-1,3,3-trimethylurea;bis(1,2,3-trimethylguanidine).
| Compound Name | N,N-dimethylmethanamine;1-ethyl-1,3,3-trimethylurea;bis(1,2,3-trimethylguanidine) |
|---|---|
| PubChem CID | 54023673 |
| Molecular Formula | C17H45N9O |
| Molecular Weight | 391.61 g/mol |
| Exact Mass | 391.37 |
| IUPAC Name | N,N-dimethylmethanamine;1-ethyl-1,3,3-trimethylurea;bis(1,2,3-trimethylguanidine) |
| SMILES | CCN(C)C(=O)N(C)C.CN(C)C.CN=C(NC)NC.CN=C(NC)NC |
| InChI | InChI=1S/C6H14N2O.2C4H11N3.C3H9N/c1-5-8(4)6(9)7(2)3;2*1-5-4(6-2)7-3;1-4(2)3/h5H2,1-4H3;2*1-3H3,(H2,5,6,7);1-3H3 |
| InChIKey | LAQZKKZCPJVCFX-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 99.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.61 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|