C12H11F6NO2 — CID 54023974
1,1,1,3,3,3-hexafluoro-2-(3-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-yl)propan-2-ol (PubChem CID 54023974) has the molecular formula C12H11F6NO2 and a molecular weight of 315.21 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(3-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-yl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(3-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-yl)propan-2-ol |
|---|---|
| PubChem CID | 54023974 |
| Molecular Formula | C12H11F6NO2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(3-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-yl)propan-2-ol |
| SMILES | CC1COc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2N1 |
| InChI | InChI=1S/C12H11F6NO2/c1-6-5-21-9-4-7(2-3-8(9)19-6)10(20,11(13,14)15)12(16,17)18/h2-4,6,19-20H,5H2,1H3 |
| InChIKey | LAWKGRXBICXCMF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |