About 2-azido-3,4,5,6-tetrafluorobenzaldehyde
2-azido-3,4,5,6-tetrafluorobenzaldehyde (PubChem CID 54024165) has the molecular formula C7HF4N3O
and a molecular weight of 219.10 g/mol. Its IUPAC name is 2-azido-3,4,5,6-tetrafluorobenzaldehyde.
Molecular Properties
| Compound Name | 2-azido-3,4,5,6-tetrafluorobenzaldehyde |
| PubChem CID | 54024165 |
| Molecular Formula | C7HF4N3O |
| Molecular Weight | 219.10 g/mol |
| Exact Mass | 219.01 |
| IUPAC Name | 2-azido-3,4,5,6-tetrafluorobenzaldehyde |
| SMILES | [N-]=[N+]=Nc1c(F)c(F)c(F)c(F)c1C=O |
| InChI | InChI=1S/C7HF4N3O/c8-3-2(1-15)7(13-14-12)6(11)5(10)4(3)9/h1H |
| InChIKey | MSKBNFOGOIKVBZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.10 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-azido-3,4,5,6-tetrafluorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azido-3,4,5,6-tetrafluorobenzaldehyde?
The IUPAC name of 2-azido-3,4,5,6-tetrafluorobenzaldehyde (CID 54024165) is 2-azido-3,4,5,6-tetrafluorobenzaldehyde.
What is the SMILES notation for 2-azido-3,4,5,6-tetrafluorobenzaldehyde?
The canonical SMILES for 2-azido-3,4,5,6-tetrafluorobenzaldehyde is [N-]=[N+]=Nc1c(F)c(F)c(F)c(F)c1C=O.
What is the InChIKey of 2-azido-3,4,5,6-tetrafluorobenzaldehyde?
The InChIKey is MSKBNFOGOIKVBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7HF4N3O/c8-3-2(1-15)7(13-14-12)6(11)5(10)4(3)9/h1H.
What are the key properties of 2-azido-3,4,5,6-tetrafluorobenzaldehyde?
2-azido-3,4,5,6-tetrafluorobenzaldehyde has a molecular weight of 219.10 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azido-3,4,5,6-tetrafluorobenzaldehyde is sourced from PubChem (CID 54024165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).