C19H14O — CID 54024232
3-methyl-2-naphthalen-2-yl-1-benzofuran (PubChem CID 54024232) has the molecular formula C19H14O and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-methyl-2-naphthalen-2-yl-1-benzofuran.
| Compound Name | 3-methyl-2-naphthalen-2-yl-1-benzofuran |
|---|---|
| PubChem CID | 54024232 |
| Molecular Formula | C19H14O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 3-methyl-2-naphthalen-2-yl-1-benzofuran |
| SMILES | Cc1c(-c2ccc3ccccc3c2)oc2ccccc12 |
| InChI | InChI=1S/C19H14O/c1-13-17-8-4-5-9-18(17)20-19(13)16-11-10-14-6-2-3-7-15(14)12-16/h2-12H,1H3 |
| InChIKey | LBAVLWLJIPVZSK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |