C15H27FO — CID 54024531
1-fluoro-10-methoxy-3,7,10-trimethylundeca-2,4-diene (PubChem CID 54024531) has the molecular formula C15H27FO and a molecular weight of 242.38 g/mol. Its IUPAC name is 1-fluoro-10-methoxy-3,7,10-trimethylundeca-2,4-diene.
| Compound Name | 1-fluoro-10-methoxy-3,7,10-trimethylundeca-2,4-diene |
|---|---|
| PubChem CID | 54024531 |
| Molecular Formula | C15H27FO |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1-fluoro-10-methoxy-3,7,10-trimethylundeca-2,4-diene |
| SMILES | COC(C)(C)CCC(C)CC=CC(C)=CCF |
| InChI | InChI=1S/C15H27FO/c1-13(9-11-15(3,4)17-5)7-6-8-14(2)10-12-16/h6,8,10,13H,7,9,11-12H2,1-5H3 |
| InChIKey | LBGAXTPKCONGMD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|