About 2-methylbutan-2-yloxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl carbonate
2-methylbutan-2-yloxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl carbonate (PubChem CID 54025336) has the molecular formula C14H21NO6
and a molecular weight of 299.32 g/mol. Its IUPAC name is 2-methylbutan-2-yloxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl carbonate.
Molecular Properties
| Compound Name | 2-methylbutan-2-yloxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl carbonate |
| PubChem CID | 54025336 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 2-methylbutan-2-yloxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl carbonate |
| SMILES | CCC(C)(C)OOC(=O)OCCCN1C(=O)C=C(C)C1=O |
| InChI | InChI=1S/C14H21NO6/c1-5-14(3,4)21-20-13(18)19-8-6-7-15-11(16)9-10(2)12(15)17/h9H,5-8H2,1-4H3 |
| InChIKey | LBTXLIFWABJYSO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutan-2-yloxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutan-2-yloxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl carbonate?
The IUPAC name of 2-methylbutan-2-yloxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl carbonate (CID 54025336) is 2-methylbutan-2-yloxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl carbonate.
What is the SMILES notation for 2-methylbutan-2-yloxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl carbonate?
The canonical SMILES for 2-methylbutan-2-yloxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl carbonate is CCC(C)(C)OOC(=O)OCCCN1C(=O)C=C(C)C1=O.
What is the InChIKey of 2-methylbutan-2-yloxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl carbonate?
The InChIKey is LBTXLIFWABJYSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO6/c1-5-14(3,4)21-20-13(18)19-8-6-7-15-11(16)9-10(2)12(15)17/h9H,5-8H2,1-4H3.
What are the key properties of 2-methylbutan-2-yloxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl carbonate?
2-methylbutan-2-yloxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl carbonate has a molecular weight of 299.32 g/mol, XLogP of 1.97, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-2-yloxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propyl carbonate is sourced from PubChem (CID 54025336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).