C16H8F23NO4 — CID 54025923
2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propoxy]-N-methyl-N-prop-2-enylpropanamide (PubChem CID 54025923) has the molecular formula C16H8F23NO4 and a molecular weight of 715.20 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propoxy]-N-methyl-N-prop-2-enylpropanamide.
| Compound Name | 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propoxy]-N-methyl-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 54025923 |
| Molecular Formula | C16H8F23NO4 |
| Molecular Weight | 715.20 g/mol |
| Exact Mass | 715.01 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propoxy]-N-methyl-N-prop-2-enylpropanamide |
| SMILES | C=CCN(C)C(=O)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H8F23NO4/c1-3-4-40(2)5(41)6(17,10(22,23)24)42-15(36,37)8(20,12(28,29)30)44-16(38,39)9(21,13(31,32)33)43-14(34,35)7(18,19)11(25,26)27/h3H,1,4H2,2H3 |
| InChIKey | LCDWAASWPXMFTR-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.20 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|