C16H17NO3 — CID 5402606
(NE)-N-[1,2-bis(4-methoxyphenyl)ethylidene]hydroxylamine (PubChem CID 5402606) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is (NE)-N-[1,2-bis(4-methoxyphenyl)ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1,2-bis(4-methoxyphenyl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 5402606 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (NE)-N-[1,2-bis(4-methoxyphenyl)ethylidene]hydroxylamine |
| SMILES | COc1ccc(C/C(=N\O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C16H17NO3/c1-19-14-7-3-12(4-8-14)11-16(17-18)13-5-9-15(20-2)10-6-13/h3-10,18H,11H2,1-2H3/b17-16+ |
| InChIKey | HQIRMFJXORPNQN-WUKNDPDISA-N |
| XLogP | 3.12 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|