C26H51N — CID 54026446
N,N-bis(2-ethylhexyl)-3,7-dimethylocta-2,6-dien-1-amine (PubChem CID 54026446) has the molecular formula C26H51N and a molecular weight of 377.70 g/mol. Its IUPAC name is N,N-bis(2-ethylhexyl)-3,7-dimethylocta-2,6-dien-1-amine.
| Compound Name | N,N-bis(2-ethylhexyl)-3,7-dimethylocta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 54026446 |
| Molecular Formula | C26H51N |
| Molecular Weight | 377.70 g/mol |
| Exact Mass | 377.40 |
| IUPAC Name | N,N-bis(2-ethylhexyl)-3,7-dimethylocta-2,6-dien-1-amine |
| SMILES | CCCCC(CC)CN(CC=C(C)CCC=C(C)C)CC(CC)CCCC |
| InChI | InChI=1S/C26H51N/c1-8-12-17-25(10-3)21-27(22-26(11-4)18-13-9-2)20-19-24(7)16-14-15-23(5)6/h15,19,25-26H,8-14,16-18,20-22H2,1-7H3 |
| InChIKey | LCNBGCZFMCKPQX-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.70 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|