C17H13F6NO2 — CID 54026611
2-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-4,7-dihydroisoindole-1,3-diol (PubChem CID 54026611) has the molecular formula C17H13F6NO2 and a molecular weight of 377.28 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-4,7-dihydroisoindole-1,3-diol.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-4,7-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54026611 |
| Molecular Formula | C17H13F6NO2 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-4,7-dihydroisoindole-1,3-diol |
| SMILES | CC1=CCc2c(c(O)n(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2O)C1 |
| InChI | InChI=1S/C17H13F6NO2/c1-8-2-3-12-13(4-8)15(26)24(14(12)25)11-6-9(16(18,19)20)5-10(7-11)17(21,22)23/h2,5-7,25-26H,3-4H2,1H3 |
| InChIKey | LCPUGMHXURRAED-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|