C8H14O2 — CID 54026687
(3S,6S)-3,6-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 54026687) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is (3S,6S)-3,6-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3S,6S)-3,6-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 54026687 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | (3S,6S)-3,6-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | C[C@H]1COC2C1OC[C@@H]2C |
| InChI | InChI=1S/C8H14O2/c1-5-3-9-8-6(2)4-10-7(5)8/h5-8H,3-4H2,1-2H3/t5-,6-,7?,8?/m0/s1 |
| InChIKey | LCRDYQLDFQLXMG-LHZZQDSXSA-N |
| XLogP | 1.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |