About 2-(2-azidopropan-2-yl)-3,4,5-trimethyloxolane
2-(2-azidopropan-2-yl)-3,4,5-trimethyloxolane (PubChem CID 54026763) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-(2-azidopropan-2-yl)-3,4,5-trimethyloxolane.
Molecular Properties
| Compound Name | 2-(2-azidopropan-2-yl)-3,4,5-trimethyloxolane |
| PubChem CID | 54026763 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 2-(2-azidopropan-2-yl)-3,4,5-trimethyloxolane |
| SMILES | CC1OC(C(C)(C)N=[N+]=[N-])C(C)C1C |
| InChI | InChI=1S/C10H19N3O/c1-6-7(2)9(14-8(6)3)10(4,5)12-13-11/h6-9H,1-5H3 |
| InChIKey | LCSNQDMIZGVXMJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-azidopropan-2-yl)-3,4,5-trimethyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-azidopropan-2-yl)-3,4,5-trimethyloxolane?
The IUPAC name of 2-(2-azidopropan-2-yl)-3,4,5-trimethyloxolane (CID 54026763) is 2-(2-azidopropan-2-yl)-3,4,5-trimethyloxolane.
What is the SMILES notation for 2-(2-azidopropan-2-yl)-3,4,5-trimethyloxolane?
The canonical SMILES for 2-(2-azidopropan-2-yl)-3,4,5-trimethyloxolane is CC1OC(C(C)(C)N=[N+]=[N-])C(C)C1C.
What is the InChIKey of 2-(2-azidopropan-2-yl)-3,4,5-trimethyloxolane?
The InChIKey is LCSNQDMIZGVXMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O/c1-6-7(2)9(14-8(6)3)10(4,5)12-13-11/h6-9H,1-5H3.
What are the key properties of 2-(2-azidopropan-2-yl)-3,4,5-trimethyloxolane?
2-(2-azidopropan-2-yl)-3,4,5-trimethyloxolane has a molecular weight of 197.28 g/mol, XLogP of 3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-azidopropan-2-yl)-3,4,5-trimethyloxolane is sourced from PubChem (CID 54026763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).