About 1,1-diethyl-3-nitrosourea
1,1-diethyl-3-nitrosourea (PubChem CID 54027501) has the molecular formula C5H11N3O2
and a molecular weight of 145.16 g/mol. Its IUPAC name is 1,1-diethyl-3-nitrosourea.
Molecular Properties
| Compound Name | 1,1-diethyl-3-nitrosourea |
| PubChem CID | 54027501 |
| Molecular Formula | C5H11N3O2 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 1,1-diethyl-3-nitrosourea |
| SMILES | CCN(CC)C(=O)NN=O |
| InChI | InChI=1S/C5H11N3O2/c1-3-8(4-2)5(9)6-7-10/h3-4H2,1-2H3,(H,6,9,10) |
| InChIKey | LDGCNNLMRHMBGY-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diethyl-3-nitrosourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethyl-3-nitrosourea?
The IUPAC name of 1,1-diethyl-3-nitrosourea (CID 54027501) is 1,1-diethyl-3-nitrosourea.
What is the SMILES notation for 1,1-diethyl-3-nitrosourea?
The canonical SMILES for 1,1-diethyl-3-nitrosourea is CCN(CC)C(=O)NN=O.
What is the InChIKey of 1,1-diethyl-3-nitrosourea?
The InChIKey is LDGCNNLMRHMBGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O2/c1-3-8(4-2)5(9)6-7-10/h3-4H2,1-2H3,(H,6,9,10).
What are the key properties of 1,1-diethyl-3-nitrosourea?
1,1-diethyl-3-nitrosourea has a molecular weight of 145.16 g/mol, XLogP of 0.72, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethyl-3-nitrosourea is sourced from PubChem (CID 54027501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).