About but-2-enyl 2-chloroacetate
but-2-enyl 2-chloroacetate (PubChem CID 54027946) has the molecular formula C6H9ClO2
and a molecular weight of 148.59 g/mol. Its IUPAC name is but-2-enyl 2-chloroacetate.
Molecular Properties
| Compound Name | but-2-enyl 2-chloroacetate |
| PubChem CID | 54027946 |
| Molecular Formula | C6H9ClO2 |
| Molecular Weight | 148.59 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | but-2-enyl 2-chloroacetate |
| SMILES | CC=CCOC(=O)CCl |
| InChI | InChI=1S/C6H9ClO2/c1-2-3-4-9-6(8)5-7/h2-3H,4-5H2,1H3 |
| InChIKey | LDOGQJBJIGUTBQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.59 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-2-enyl 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enyl 2-chloroacetate?
The IUPAC name of but-2-enyl 2-chloroacetate (CID 54027946) is but-2-enyl 2-chloroacetate.
What is the SMILES notation for but-2-enyl 2-chloroacetate?
The canonical SMILES for but-2-enyl 2-chloroacetate is CC=CCOC(=O)CCl.
What is the InChIKey of but-2-enyl 2-chloroacetate?
The InChIKey is LDOGQJBJIGUTBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClO2/c1-2-3-4-9-6(8)5-7/h2-3H,4-5H2,1H3.
What are the key properties of but-2-enyl 2-chloroacetate?
but-2-enyl 2-chloroacetate has a molecular weight of 148.59 g/mol, XLogP of 1.34, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enyl 2-chloroacetate is sourced from PubChem (CID 54027946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).