About 3-N-phenylpyridazine-3,6-diamine
3-N-phenylpyridazine-3,6-diamine (PubChem CID 54028052) has the molecular formula C10H10N4
and a molecular weight of 186.22 g/mol. Its IUPAC name is 3-N-phenylpyridazine-3,6-diamine.
Molecular Properties
| Compound Name | 3-N-phenylpyridazine-3,6-diamine |
| PubChem CID | 54028052 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 3-N-phenylpyridazine-3,6-diamine |
| SMILES | Nc1ccc(Nc2ccccc2)nn1 |
| InChI | InChI=1S/C10H10N4/c11-9-6-7-10(14-13-9)12-8-4-2-1-3-5-8/h1-7H,(H2,11,13)(H,12,14) |
| InChIKey | LDPYGFJKSVASMG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-N-phenylpyridazine-3,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-phenylpyridazine-3,6-diamine?
The IUPAC name of 3-N-phenylpyridazine-3,6-diamine (CID 54028052) is 3-N-phenylpyridazine-3,6-diamine.
What is the SMILES notation for 3-N-phenylpyridazine-3,6-diamine?
The canonical SMILES for 3-N-phenylpyridazine-3,6-diamine is Nc1ccc(Nc2ccccc2)nn1.
What is the InChIKey of 3-N-phenylpyridazine-3,6-diamine?
The InChIKey is LDPYGFJKSVASMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4/c11-9-6-7-10(14-13-9)12-8-4-2-1-3-5-8/h1-7H,(H2,11,13)(H,12,14).
What are the key properties of 3-N-phenylpyridazine-3,6-diamine?
3-N-phenylpyridazine-3,6-diamine has a molecular weight of 186.22 g/mol, XLogP of 1.80, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-phenylpyridazine-3,6-diamine is sourced from PubChem (CID 54028052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).