About [5-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)naphthalen-2-yl] trifluoromethanesulfonate
[5-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)naphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 54028562) has the molecular formula C21H18F3N3O3S
and a molecular weight of 449.45 g/mol. Its IUPAC name is [5-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)naphthalen-2-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [5-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)naphthalen-2-yl] trifluoromethanesulfonate |
| PubChem CID | 54028562 |
| Molecular Formula | C21H18F3N3O3S |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | [5-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)naphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | CCc1nc2c(C)cc(C)nc2n1-c1cccc2cc(OS(=O)(=O)C(F)(F)F)ccc12 |
| InChI | InChI=1S/C21H18F3N3O3S/c1-4-18-26-19-12(2)10-13(3)25-20(19)27(18)17-7-5-6-14-11-15(8-9-16(14)17)30-31(28,29)21(22,23)24/h5-11H,4H2,1-3H3 |
| InChIKey | LDYFPUZEGXKKGX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [5-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)naphthalen-2-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)naphthalen-2-yl] trifluoromethanesulfonate?
The IUPAC name of [5-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)naphthalen-2-yl] trifluoromethanesulfonate (CID 54028562) is [5-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)naphthalen-2-yl] trifluoromethanesulfonate.
What is the SMILES notation for [5-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)naphthalen-2-yl] trifluoromethanesulfonate?
The canonical SMILES for [5-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)naphthalen-2-yl] trifluoromethanesulfonate is CCc1nc2c(C)cc(C)nc2n1-c1cccc2cc(OS(=O)(=O)C(F)(F)F)ccc12.
What is the InChIKey of [5-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)naphthalen-2-yl] trifluoromethanesulfonate?
The InChIKey is LDYFPUZEGXKKGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F3N3O3S/c1-4-18-26-19-12(2)10-13(3)25-20(19)27(18)17-7-5-6-14-11-15(8-9-16(14)17)30-31(28,29)21(22,23)24/h5-11H,4H2,1-3H3.
What are the key properties of [5-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)naphthalen-2-yl] trifluoromethanesulfonate?
[5-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)naphthalen-2-yl] trifluoromethanesulfonate has a molecular weight of 449.45 g/mol, XLogP of 4.98, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)naphthalen-2-yl] trifluoromethanesulfonate is sourced from PubChem (CID 54028562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).