C17H11FN6O3 — CID 54029123
7-fluoro-3-[3-(1-hydroxycyclopropyl)-1,2,4-oxadiazol-5-yl]-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-6-carbonitrile (PubChem CID 54029123) has the molecular formula C17H11FN6O3 and a molecular weight of 366.31 g/mol. Its IUPAC name is 7-fluoro-3-[3-(1-hydroxycyclopropyl)-1,2,4-oxadiazol-5-yl]-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-6-carbonitrile.
| Compound Name | 7-fluoro-3-[3-(1-hydroxycyclopropyl)-1,2,4-oxadiazol-5-yl]-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-6-carbonitrile |
|---|---|
| PubChem CID | 54029123 |
| Molecular Formula | C17H11FN6O3 |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 7-fluoro-3-[3-(1-hydroxycyclopropyl)-1,2,4-oxadiazol-5-yl]-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-6-carbonitrile |
| SMILES | Cc1c2c(-c3nc(C4(O)CC4)no3)ncn2c2ccc(F)c(C#N)c2[n+]1[O-] |
| InChI | InChI=1S/C17H11FN6O3/c1-8-13-12(15-21-16(22-27-15)17(25)4-5-17)20-7-23(13)11-3-2-10(18)9(6-19)14(11)24(8)26/h2-3,7,25H,4-5H2,1H3 |
| InChIKey | LEIDMXMORSFLBK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|