C21H33N3O2 — CID 54029679
1-[(2-benzylidenecyclohexylidene)amino]oxy-3-[3-(dimethylamino)propylamino]propan-2-ol (PubChem CID 54029679) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is 1-[(2-benzylidenecyclohexylidene)amino]oxy-3-[3-(dimethylamino)propylamino]propan-2-ol.
| Compound Name | 1-[(2-benzylidenecyclohexylidene)amino]oxy-3-[3-(dimethylamino)propylamino]propan-2-ol |
|---|---|
| PubChem CID | 54029679 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 1-[(2-benzylidenecyclohexylidene)amino]oxy-3-[3-(dimethylamino)propylamino]propan-2-ol |
| SMILES | CN(C)CCCNCC(O)CON=C1CCCCC1=Cc1ccccc1 |
| InChI | InChI=1S/C21H33N3O2/c1-24(2)14-8-13-22-16-20(25)17-26-23-21-12-7-6-11-19(21)15-18-9-4-3-5-10-18/h3-5,9-10,15,20,22,25H,6-8,11-14,16-17H2,1-2H3 |
| InChIKey | LERQQNSJJPTHHY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|