C21H21NO7S — CID 54029748
dimethyl 1-(benzenesulfonyl)-5-(2-oxopropyl)-3H-indole-2,2-dicarboxylate (PubChem CID 54029748) has the molecular formula C21H21NO7S and a molecular weight of 431.47 g/mol. Its IUPAC name is dimethyl 1-(benzenesulfonyl)-5-(2-oxopropyl)-3H-indole-2,2-dicarboxylate.
| Compound Name | dimethyl 1-(benzenesulfonyl)-5-(2-oxopropyl)-3H-indole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 54029748 |
| Molecular Formula | C21H21NO7S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | dimethyl 1-(benzenesulfonyl)-5-(2-oxopropyl)-3H-indole-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2cc(CC(C)=O)ccc2N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H21NO7S/c1-14(23)11-15-9-10-18-16(12-15)13-21(19(24)28-2,20(25)29-3)22(18)30(26,27)17-7-5-4-6-8-17/h4-10,12H,11,13H2,1-3H3 |
| InChIKey | LESUPFJQGCVDCZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|