C10H20N2 — CID 54029903
1-(1,4-dimethyl-2,5-dihydropyrrol-3-yl)-N,N-dimethylethanamine (PubChem CID 54029903) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-(1,4-dimethyl-2,5-dihydropyrrol-3-yl)-N,N-dimethylethanamine.
| Compound Name | 1-(1,4-dimethyl-2,5-dihydropyrrol-3-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 54029903 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 1-(1,4-dimethyl-2,5-dihydropyrrol-3-yl)-N,N-dimethylethanamine |
| SMILES | CC1=C(C(C)N(C)C)CN(C)C1 |
| InChI | InChI=1S/C10H20N2/c1-8-6-12(5)7-10(8)9(2)11(3)4/h9H,6-7H2,1-5H3 |
| InChIKey | LEVNVJVXHXRORG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|