About 4-cyclopropyl-1,3-benzothiazol-2-amine
4-cyclopropyl-1,3-benzothiazol-2-amine (PubChem CID 54029954) has the molecular formula C10H10N2S
and a molecular weight of 190.27 g/mol. Its IUPAC name is 4-cyclopropyl-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | 4-cyclopropyl-1,3-benzothiazol-2-amine |
| PubChem CID | 54029954 |
| Molecular Formula | C10H10N2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 4-cyclopropyl-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2c(C3CC3)cccc2s1 |
| InChI | InChI=1S/C10H10N2S/c11-10-12-9-7(6-4-5-6)2-1-3-8(9)13-10/h1-3,6H,4-5H2,(H2,11,12) |
| InChIKey | LEWJILIVLFHGOF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-cyclopropyl-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-1,3-benzothiazol-2-amine?
The IUPAC name of 4-cyclopropyl-1,3-benzothiazol-2-amine (CID 54029954) is 4-cyclopropyl-1,3-benzothiazol-2-amine.
What is the SMILES notation for 4-cyclopropyl-1,3-benzothiazol-2-amine?
The canonical SMILES for 4-cyclopropyl-1,3-benzothiazol-2-amine is Nc1nc2c(C3CC3)cccc2s1.
What is the InChIKey of 4-cyclopropyl-1,3-benzothiazol-2-amine?
The InChIKey is LEWJILIVLFHGOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2S/c11-10-12-9-7(6-4-5-6)2-1-3-8(9)13-10/h1-3,6H,4-5H2,(H2,11,12).
What are the key properties of 4-cyclopropyl-1,3-benzothiazol-2-amine?
4-cyclopropyl-1,3-benzothiazol-2-amine has a molecular weight of 190.27 g/mol, XLogP of 2.76, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-1,3-benzothiazol-2-amine is sourced from PubChem (CID 54029954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).