About 3-bromo-1,2,4-trifluoro-5-methylbenzene
3-bromo-1,2,4-trifluoro-5-methylbenzene (PubChem CID 54030137) has the molecular formula C7H4BrF3
and a molecular weight of 225.01 g/mol. Its IUPAC name is 3-bromo-1,2,4-trifluoro-5-methylbenzene.
Molecular Properties
| Compound Name | 3-bromo-1,2,4-trifluoro-5-methylbenzene |
| PubChem CID | 54030137 |
| Molecular Formula | C7H4BrF3 |
| Molecular Weight | 225.01 g/mol |
| Exact Mass | 223.94 |
| IUPAC Name | 3-bromo-1,2,4-trifluoro-5-methylbenzene |
| SMILES | Cc1cc(F)c(F)c(Br)c1F |
| InChI | InChI=1S/C7H4BrF3/c1-3-2-4(9)7(11)5(8)6(3)10/h2H,1H3 |
| InChIKey | LEZQSHSBNLBVFV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.01 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-1,2,4-trifluoro-5-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1,2,4-trifluoro-5-methylbenzene?
The IUPAC name of 3-bromo-1,2,4-trifluoro-5-methylbenzene (CID 54030137) is 3-bromo-1,2,4-trifluoro-5-methylbenzene.
What is the SMILES notation for 3-bromo-1,2,4-trifluoro-5-methylbenzene?
The canonical SMILES for 3-bromo-1,2,4-trifluoro-5-methylbenzene is Cc1cc(F)c(F)c(Br)c1F.
What is the InChIKey of 3-bromo-1,2,4-trifluoro-5-methylbenzene?
The InChIKey is LEZQSHSBNLBVFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrF3/c1-3-2-4(9)7(11)5(8)6(3)10/h2H,1H3.
What are the key properties of 3-bromo-1,2,4-trifluoro-5-methylbenzene?
3-bromo-1,2,4-trifluoro-5-methylbenzene has a molecular weight of 225.01 g/mol, XLogP of 3.17, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1,2,4-trifluoro-5-methylbenzene is sourced from PubChem (CID 54030137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).