About 2-piperazin-1-ylethyl propanoate
2-piperazin-1-ylethyl propanoate (PubChem CID 54030741) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-piperazin-1-ylethyl propanoate.
Molecular Properties
| Compound Name | 2-piperazin-1-ylethyl propanoate |
| PubChem CID | 54030741 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 2-piperazin-1-ylethyl propanoate |
| SMILES | CCC(=O)OCCN1CCNCC1 |
| InChI | InChI=1S/C9H18N2O2/c1-2-9(12)13-8-7-11-5-3-10-4-6-11/h10H,2-8H2,1H3 |
| InChIKey | LFKFPQJKBQKGQP-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-piperazin-1-ylethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-ylethyl propanoate?
The IUPAC name of 2-piperazin-1-ylethyl propanoate (CID 54030741) is 2-piperazin-1-ylethyl propanoate.
What is the SMILES notation for 2-piperazin-1-ylethyl propanoate?
The canonical SMILES for 2-piperazin-1-ylethyl propanoate is CCC(=O)OCCN1CCNCC1.
What is the InChIKey of 2-piperazin-1-ylethyl propanoate?
The InChIKey is LFKFPQJKBQKGQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-2-9(12)13-8-7-11-5-3-10-4-6-11/h10H,2-8H2,1H3.
What are the key properties of 2-piperazin-1-ylethyl propanoate?
2-piperazin-1-ylethyl propanoate has a molecular weight of 186.25 g/mol, XLogP of -0.16, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-ylethyl propanoate is sourced from PubChem (CID 54030741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).