C22H25N3O4S — CID 54030897
3-[2-[(3aR,9bR)-6-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]isoindol-3-yl]ethyl]-6-methoxy-1H-thieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 54030897) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is 3-[2-[(3aR,9bR)-6-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]isoindol-3-yl]ethyl]-6-methoxy-1H-thieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 3-[2-[(3aR,9bR)-6-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]isoindol-3-yl]ethyl]-6-methoxy-1H-thieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54030897 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 3-[2-[(3aR,9bR)-6-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]isoindol-3-yl]ethyl]-6-methoxy-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | COc1cc2[nH]c(=O)n(CCC3NC[C@H]4c5cccc(OC)c5CC[C@@H]34)c(=O)c2s1 |
| InChI | InChI=1S/C22H25N3O4S/c1-28-18-5-3-4-12-14(18)7-6-13-15(12)11-23-16(13)8-9-25-21(26)20-17(24-22(25)27)10-19(29-2)30-20/h3-5,10,13,15-16,23H,6-9,11H2,1-2H3,(H,24,27)/t13-,15+,16?/m1/s1 |
| InChIKey | LFNDUGZCOWDERT-YISXUXMPSA-N |
| XLogP | 2.48 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |