C42H37F6N6+ — CID 54030900
3-[2-[4,4-bis(1H-indol-4-yl)-1-[2-[6-(trifluoromethyl)-1H-indol-3-yl]ethyl]piperazin-4-ium-2-yl]ethyl]-6-(trifluoromethyl)-1H-indole (PubChem CID 54030900) has the molecular formula C42H37F6N6+ and a molecular weight of 739.79 g/mol. Its IUPAC name is 3-[2-[4,4-bis(1H-indol-4-yl)-1-[2-[6-(trifluoromethyl)-1H-indol-3-yl]ethyl]piperazin-4-ium-2-yl]ethyl]-6-(trifluoromethyl)-1H-indole.
| Compound Name | 3-[2-[4,4-bis(1H-indol-4-yl)-1-[2-[6-(trifluoromethyl)-1H-indol-3-yl]ethyl]piperazin-4-ium-2-yl]ethyl]-6-(trifluoromethyl)-1H-indole |
|---|---|
| PubChem CID | 54030900 |
| Molecular Formula | C42H37F6N6+ |
| Molecular Weight | 739.79 g/mol |
| Exact Mass | 739.30 |
| IUPAC Name | 3-[2-[4,4-bis(1H-indol-4-yl)-1-[2-[6-(trifluoromethyl)-1H-indol-3-yl]ethyl]piperazin-4-ium-2-yl]ethyl]-6-(trifluoromethyl)-1H-indole |
| SMILES | FC(F)(F)c1ccc2c(CCC3C[N+](c4cccc5[nH]ccc45)(c4cccc5[nH]ccc45)CCN3CCc3c[nH]c4cc(C(F)(F)F)ccc34)c[nH]c2c1 |
| InChI | InChI=1S/C42H37F6N6/c43-41(44,45)28-8-11-31-26(23-51-37(31)21-28)7-10-30-25-54(39-5-1-3-35-33(39)13-16-49-35,40-6-2-4-36-34(40)14-17-50-36)20-19-53(30)18-15-27-24-52-38-22-29(42(46,47)48)9-12-32(27)38/h1-6,8-9,11-14,16-17,21-24,30,49-52H,7,10,15,18-20,25H2/q+1 |
| InChIKey | NESPQEMLURLKOH-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.79 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|