C38H50N4O — CID 54030938
7-[4,4-dimethyl-6-[methyl(3-methylbutyl)amino]hexyl]imino-N,N-diethylnaphtho[2,3-a]phenoxazin-3-amine (PubChem CID 54030938) has the molecular formula C38H50N4O and a molecular weight of 578.85 g/mol. Its IUPAC name is 7-[4,4-dimethyl-6-[methyl(3-methylbutyl)amino]hexyl]imino-N,N-diethylnaphtho[2,3-a]phenoxazin-3-amine.
| Compound Name | 7-[4,4-dimethyl-6-[methyl(3-methylbutyl)amino]hexyl]imino-N,N-diethylnaphtho[2,3-a]phenoxazin-3-amine |
|---|---|
| PubChem CID | 54030938 |
| Molecular Formula | C38H50N4O |
| Molecular Weight | 578.85 g/mol |
| Exact Mass | 578.40 |
| IUPAC Name | 7-[4,4-dimethyl-6-[methyl(3-methylbutyl)amino]hexyl]imino-N,N-diethylnaphtho[2,3-a]phenoxazin-3-amine |
| SMILES | CCN(CC)c1ccc2nc3c4cc5ccccc5cc4/c(=N/CCCC(C)(C)CCN(C)CCC(C)C)cc-3oc2c1 |
| InChI | InChI=1S/C38H50N4O/c1-8-42(9-2)30-15-16-33-35(25-30)43-36-26-34(31-23-28-13-10-11-14-29(28)24-32(31)37(36)40-33)39-20-12-18-38(5,6)19-22-41(7)21-17-27(3)4/h10-11,13-16,23-27H,8-9,12,17-22H2,1-7H3/b39-34+ |
| InChIKey | LFNWBKQJBLYSKT-JQJRJOTLSA-N |
| XLogP | 9.16 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.85 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|