C66H48O12S6 — CID 54030980
S-[3,6,7,10,11-pentakis[(4-methoxybenzoyl)sulfanyl]triphenylen-2-yl] 4-methoxybenzenecarbothioate (PubChem CID 54030980) has the molecular formula C66H48O12S6 and a molecular weight of 1225.50 g/mol. Its IUPAC name is S-[3,6,7,10,11-pentakis[(4-methoxybenzoyl)sulfanyl]triphenylen-2-yl] 4-methoxybenzenecarbothioate.
| Compound Name | S-[3,6,7,10,11-pentakis[(4-methoxybenzoyl)sulfanyl]triphenylen-2-yl] 4-methoxybenzenecarbothioate |
|---|---|
| PubChem CID | 54030980 |
| Molecular Formula | C66H48O12S6 |
| Molecular Weight | 1225.50 g/mol |
| Exact Mass | 1224.15 |
| IUPAC Name | S-[3,6,7,10,11-pentakis[(4-methoxybenzoyl)sulfanyl]triphenylen-2-yl] 4-methoxybenzenecarbothioate |
| SMILES | COc1ccc(C(=O)Sc2cc3c4cc(SC(=O)c5ccc(OC)cc5)c(SC(=O)c5ccc(OC)cc5)cc4c4cc(SC(=O)c5ccc(OC)cc5)c(SC(=O)c5ccc(OC)cc5)cc4c3cc2SC(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C66H48O12S6/c1-73-43-19-7-37(8-20-43)61(67)79-55-31-49-50(32-56(55)80-62(68)38-9-21-44(74-2)22-10-38)52-34-58(82-64(70)40-13-25-46(76-4)26-14-40)60(84-66(72)42-17-29-48(78-6)30-18-42)36-54(52)53-35-59(83-65(71)41-15-27-47(77-5)28-16-41)57(33-51(49)53)81-63(69)39-11-23-45(75-3)24-12-39/h7-36H,1-6H3 |
| InChIKey | LFOOKFJRQZGEHV-UHFFFAOYSA-N |
| XLogP | 16.79 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1225.50 |
| LogP ≤ 5 | 16.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|