About 2,4-dimethyl-3,4-dihydropyrazole
2,4-dimethyl-3,4-dihydropyrazole (PubChem CID 54031007) has the molecular formula C5H10N2
and a molecular weight of 98.15 g/mol. Its IUPAC name is 2,4-dimethyl-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 2,4-dimethyl-3,4-dihydropyrazole |
| PubChem CID | 54031007 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | 2,4-dimethyl-3,4-dihydropyrazole |
| SMILES | CC1C=NN(C)C1 |
| InChI | InChI=1S/C5H10N2/c1-5-3-6-7(2)4-5/h3,5H,4H2,1-2H3 |
| InChIKey | LFPALJMPCHVPCQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dimethyl-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-3,4-dihydropyrazole?
The IUPAC name of 2,4-dimethyl-3,4-dihydropyrazole (CID 54031007) is 2,4-dimethyl-3,4-dihydropyrazole.
What is the SMILES notation for 2,4-dimethyl-3,4-dihydropyrazole?
The canonical SMILES for 2,4-dimethyl-3,4-dihydropyrazole is CC1C=NN(C)C1.
What is the InChIKey of 2,4-dimethyl-3,4-dihydropyrazole?
The InChIKey is LFPALJMPCHVPCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2/c1-5-3-6-7(2)4-5/h3,5H,4H2,1-2H3.
What are the key properties of 2,4-dimethyl-3,4-dihydropyrazole?
2,4-dimethyl-3,4-dihydropyrazole has a molecular weight of 98.15 g/mol, XLogP of 0.55, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-3,4-dihydropyrazole is sourced from PubChem (CID 54031007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).