C16H14N6O — CID 54031145
2-(6-methyl-1-oxidopyridin-1-ium-3-yl)-5,6-dihydropyrimido[4,5-f]quinazolin-8-amine (PubChem CID 54031145) has the molecular formula C16H14N6O and a molecular weight of 306.33 g/mol. Its IUPAC name is 2-(6-methyl-1-oxidopyridin-1-ium-3-yl)-5,6-dihydropyrimido[4,5-f]quinazolin-8-amine.
| Compound Name | 2-(6-methyl-1-oxidopyridin-1-ium-3-yl)-5,6-dihydropyrimido[4,5-f]quinazolin-8-amine |
|---|---|
| PubChem CID | 54031145 |
| Molecular Formula | C16H14N6O |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-(6-methyl-1-oxidopyridin-1-ium-3-yl)-5,6-dihydropyrimido[4,5-f]quinazolin-8-amine |
| SMILES | Cc1ccc(-c2ncc3c(n2)-c2cnc(N)nc2CC3)c[n+]1[O-] |
| InChI | InChI=1S/C16H14N6O/c1-9-2-3-11(8-22(9)23)15-18-6-10-4-5-13-12(14(10)21-15)7-19-16(17)20-13/h2-3,6-8H,4-5H2,1H3,(H2,17,19,20) |
| InChIKey | LFRQBUSPMOIFJQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|