C18H13N — CID 54031191
10-azatetracyclo[9.8.0.02,9.012,17]nonadeca-1,3,5,7,9,11,14,16,18-nonaene (PubChem CID 54031191) has the molecular formula C18H13N and a molecular weight of 243.31 g/mol. Its IUPAC name is 10-azatetracyclo[9.8.0.02,9.012,17]nonadeca-1,3,5,7,9,11,14,16,18-nonaene.
| Compound Name | 10-azatetracyclo[9.8.0.02,9.012,17]nonadeca-1,3,5,7,9,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 54031191 |
| Molecular Formula | C18H13N |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 10-azatetracyclo[9.8.0.02,9.012,17]nonadeca-1,3,5,7,9,11,14,16,18-nonaene |
| SMILES | C1=CC=CC2=c3ccc4c(c3N=C2C=C1)CC=CC=4 |
| InChI | InChI=1S/C18H13N/c1-2-4-10-17-15(9-3-1)16-12-11-13-7-5-6-8-14(13)18(16)19-17/h1-7,9-12H,8H2 |
| InChIKey | LFSIZNFMUXMXAF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |