C13H17NO — CID 54031293
(4aS,10aS)-1,2,3,4,4a,5,10,10a-octahydrobenzo[g]quinolin-7-ol (PubChem CID 54031293) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is (4aS,10aS)-1,2,3,4,4a,5,10,10a-octahydrobenzo[g]quinolin-7-ol.
| Compound Name | (4aS,10aS)-1,2,3,4,4a,5,10,10a-octahydrobenzo[g]quinolin-7-ol |
|---|---|
| PubChem CID | 54031293 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (4aS,10aS)-1,2,3,4,4a,5,10,10a-octahydrobenzo[g]quinolin-7-ol |
| SMILES | Oc1ccc2c(c1)C[C@@H]1CCCN[C@H]1C2 |
| InChI | InChI=1S/C13H17NO/c15-12-4-3-9-8-13-10(2-1-5-14-13)6-11(9)7-12/h3-4,7,10,13-15H,1-2,5-6,8H2/t10-,13-/m0/s1 |
| InChIKey | LFUCQBCYFTZJHM-GWCFXTLKSA-N |
| XLogP | 1.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |