About S-tert-butyl 4,6-dimethylpyridine-2-carbothioate
S-tert-butyl 4,6-dimethylpyridine-2-carbothioate (PubChem CID 54031356) has the molecular formula C12H17NOS
and a molecular weight of 223.34 g/mol. Its IUPAC name is S-tert-butyl 4,6-dimethylpyridine-2-carbothioate.
Molecular Properties
| Compound Name | S-tert-butyl 4,6-dimethylpyridine-2-carbothioate |
| PubChem CID | 54031356 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | S-tert-butyl 4,6-dimethylpyridine-2-carbothioate |
| SMILES | Cc1cc(C)nc(C(=O)SC(C)(C)C)c1 |
| InChI | InChI=1S/C12H17NOS/c1-8-6-9(2)13-10(7-8)11(14)15-12(3,4)5/h6-7H,1-5H3 |
| InChIKey | LFVDWJMQCCEZRK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-tert-butyl 4,6-dimethylpyridine-2-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-tert-butyl 4,6-dimethylpyridine-2-carbothioate?
The IUPAC name of S-tert-butyl 4,6-dimethylpyridine-2-carbothioate (CID 54031356) is S-tert-butyl 4,6-dimethylpyridine-2-carbothioate.
What is the SMILES notation for S-tert-butyl 4,6-dimethylpyridine-2-carbothioate?
The canonical SMILES for S-tert-butyl 4,6-dimethylpyridine-2-carbothioate is Cc1cc(C)nc(C(=O)SC(C)(C)C)c1.
What is the InChIKey of S-tert-butyl 4,6-dimethylpyridine-2-carbothioate?
The InChIKey is LFVDWJMQCCEZRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NOS/c1-8-6-9(2)13-10(7-8)11(14)15-12(3,4)5/h6-7H,1-5H3.
What are the key properties of S-tert-butyl 4,6-dimethylpyridine-2-carbothioate?
S-tert-butyl 4,6-dimethylpyridine-2-carbothioate has a molecular weight of 223.34 g/mol, XLogP of 3.37, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-tert-butyl 4,6-dimethylpyridine-2-carbothioate is sourced from PubChem (CID 54031356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).