C33H30F5N3O2 — CID 54031406
2,7-difluoro-9-[4-[4-(1-hydroxyisoindol-2-yl)piperidin-1-yl]but-2-enyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 54031406) has the molecular formula C33H30F5N3O2 and a molecular weight of 595.61 g/mol. Its IUPAC name is 2,7-difluoro-9-[4-[4-(1-hydroxyisoindol-2-yl)piperidin-1-yl]but-2-enyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 2,7-difluoro-9-[4-[4-(1-hydroxyisoindol-2-yl)piperidin-1-yl]but-2-enyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 54031406 |
| Molecular Formula | C33H30F5N3O2 |
| Molecular Weight | 595.61 g/mol |
| Exact Mass | 595.23 |
| IUPAC Name | 2,7-difluoro-9-[4-[4-(1-hydroxyisoindol-2-yl)piperidin-1-yl]but-2-enyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1(CC=CCN2CCC(n3cc4ccccc4c3O)CC2)c2cc(F)ccc2-c2ccc(F)cc21 |
| InChI | InChI=1S/C33H30F5N3O2/c34-22-7-9-26-27-10-8-23(35)18-29(27)32(28(26)17-22,31(43)39-20-33(36,37)38)13-3-4-14-40-15-11-24(12-16-40)41-19-21-5-1-2-6-25(21)30(41)42/h1-10,17-19,24,42H,11-16,20H2,(H,39,43) |
| InChIKey | LFVZWOOPZHSNGE-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.61 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|