About 3-(2-aminoethyl)tricyclo[5.2.1.02,6]decan-4-amine
3-(2-aminoethyl)tricyclo[5.2.1.02,6]decan-4-amine (PubChem CID 54031632) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 3-(2-aminoethyl)tricyclo[5.2.1.02,6]decan-4-amine.
Molecular Properties
| Compound Name | 3-(2-aminoethyl)tricyclo[5.2.1.02,6]decan-4-amine |
| PubChem CID | 54031632 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 3-(2-aminoethyl)tricyclo[5.2.1.02,6]decan-4-amine |
| SMILES | NCCC1C(N)CC2C3CCC(C3)C12 |
| InChI | InChI=1S/C12H22N2/c13-4-3-9-11(14)6-10-7-1-2-8(5-7)12(9)10/h7-12H,1-6,13-14H2 |
| InChIKey | LGAAFWZULICUON-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-aminoethyl)tricyclo[5.2.1.02,6]decan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminoethyl)tricyclo[5.2.1.02,6]decan-4-amine?
The IUPAC name of 3-(2-aminoethyl)tricyclo[5.2.1.02,6]decan-4-amine (CID 54031632) is 3-(2-aminoethyl)tricyclo[5.2.1.02,6]decan-4-amine.
What is the SMILES notation for 3-(2-aminoethyl)tricyclo[5.2.1.02,6]decan-4-amine?
The canonical SMILES for 3-(2-aminoethyl)tricyclo[5.2.1.02,6]decan-4-amine is NCCC1C(N)CC2C3CCC(C3)C12.
What is the InChIKey of 3-(2-aminoethyl)tricyclo[5.2.1.02,6]decan-4-amine?
The InChIKey is LGAAFWZULICUON-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2/c13-4-3-9-11(14)6-10-7-1-2-8(5-7)12(9)10/h7-12H,1-6,13-14H2.
What are the key properties of 3-(2-aminoethyl)tricyclo[5.2.1.02,6]decan-4-amine?
3-(2-aminoethyl)tricyclo[5.2.1.02,6]decan-4-amine has a molecular weight of 194.32 g/mol, XLogP of 1.34, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminoethyl)tricyclo[5.2.1.02,6]decan-4-amine is sourced from PubChem (CID 54031632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).