C33H40N4 — CID 54031751
4,5,9,10,14,15,22,23,24-nonamethyl-25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1,3,5,7,9,11,13,15,17,19-decaene (PubChem CID 54031751) has the molecular formula C33H40N4 and a molecular weight of 492.71 g/mol. Its IUPAC name is 4,5,9,10,14,15,22,23,24-nonamethyl-25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1,3,5,7,9,11,13,15,17,19-decaene.
| Compound Name | 4,5,9,10,14,15,22,23,24-nonamethyl-25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1,3,5,7,9,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 54031751 |
| Molecular Formula | C33H40N4 |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.33 |
| IUPAC Name | 4,5,9,10,14,15,22,23,24-nonamethyl-25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1,3,5,7,9,11,13,15,17,19-decaene |
| SMILES | Cc1c2[nH]c(c1C)C=c1[nH]c(c(C)c1C)=Cc1[nH]c(c(C)c1C)C=C1NC(=C2)C2=CCC(C)C(C)C12C |
| InChI | InChI=1S/C33H40N4/c1-16-10-11-24-31-14-29-20(5)19(4)27(35-29)12-25-17(2)18(3)26(34-25)13-28-21(6)22(7)30(36-28)15-32(37-31)33(24,9)23(16)8/h11-16,23,34-37H,10H2,1-9H3 |
| InChIKey | WJRWURBFJYCVIG-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |