C38H28N2Si — CID 54032002
3-(1,1,3,4-tetraphenyl-5-pyridin-3-ylsilol-2-yl)pyridine (PubChem CID 54032002) has the molecular formula C38H28N2Si and a molecular weight of 540.74 g/mol. Its IUPAC name is 3-(1,1,3,4-tetraphenyl-5-pyridin-3-ylsilol-2-yl)pyridine.
| Compound Name | 3-(1,1,3,4-tetraphenyl-5-pyridin-3-ylsilol-2-yl)pyridine |
|---|---|
| PubChem CID | 54032002 |
| Molecular Formula | C38H28N2Si |
| Molecular Weight | 540.74 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | 3-(1,1,3,4-tetraphenyl-5-pyridin-3-ylsilol-2-yl)pyridine |
| SMILES | c1ccc(C2=C(c3cccnc3)[Si](c3ccccc3)(c3ccccc3)C(c3cccnc3)=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C38H28N2Si/c1-5-15-29(16-6-1)35-36(30-17-7-2-8-18-30)38(32-20-14-26-40-28-32)41(33-21-9-3-10-22-33,34-23-11-4-12-24-34)37(35)31-19-13-25-39-27-31/h1-28H |
| InChIKey | LGGLLZMZVARAKG-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.74 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|