About 8-methylsulfanyl-2-pyridin-2-yl-5,6-dihydropyrimido[4,5-f]quinazoline
8-methylsulfanyl-2-pyridin-2-yl-5,6-dihydropyrimido[4,5-f]quinazoline (PubChem CID 54032488) has the molecular formula C16H13N5S
and a molecular weight of 307.38 g/mol. Its IUPAC name is 8-methylsulfanyl-2-pyridin-2-yl-5,6-dihydropyrimido[4,5-f]quinazoline.
Molecular Properties
| Compound Name | 8-methylsulfanyl-2-pyridin-2-yl-5,6-dihydropyrimido[4,5-f]quinazoline |
| PubChem CID | 54032488 |
| Molecular Formula | C16H13N5S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 8-methylsulfanyl-2-pyridin-2-yl-5,6-dihydropyrimido[4,5-f]quinazoline |
| SMILES | CSc1ncc2c(n1)CCc1cnc(-c3ccccn3)nc1-2 |
| InChI | InChI=1S/C16H13N5S/c1-22-16-19-9-11-12(20-16)6-5-10-8-18-15(21-14(10)11)13-4-2-3-7-17-13/h2-4,7-9H,5-6H2,1H3 |
| InChIKey | LGOQGLQPJNIBQE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-methylsulfanyl-2-pyridin-2-yl-5,6-dihydropyrimido[4,5-f]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methylsulfanyl-2-pyridin-2-yl-5,6-dihydropyrimido[4,5-f]quinazoline?
The IUPAC name of 8-methylsulfanyl-2-pyridin-2-yl-5,6-dihydropyrimido[4,5-f]quinazoline (CID 54032488) is 8-methylsulfanyl-2-pyridin-2-yl-5,6-dihydropyrimido[4,5-f]quinazoline.
What is the SMILES notation for 8-methylsulfanyl-2-pyridin-2-yl-5,6-dihydropyrimido[4,5-f]quinazoline?
The canonical SMILES for 8-methylsulfanyl-2-pyridin-2-yl-5,6-dihydropyrimido[4,5-f]quinazoline is CSc1ncc2c(n1)CCc1cnc(-c3ccccn3)nc1-2.
What is the InChIKey of 8-methylsulfanyl-2-pyridin-2-yl-5,6-dihydropyrimido[4,5-f]quinazoline?
The InChIKey is LGOQGLQPJNIBQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N5S/c1-22-16-19-9-11-12(20-16)6-5-10-8-18-15(21-14(10)11)13-4-2-3-7-17-13/h2-4,7-9H,5-6H2,1H3.
What are the key properties of 8-methylsulfanyl-2-pyridin-2-yl-5,6-dihydropyrimido[4,5-f]quinazoline?
8-methylsulfanyl-2-pyridin-2-yl-5,6-dihydropyrimido[4,5-f]quinazoline has a molecular weight of 307.38 g/mol, XLogP of 2.82, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylsulfanyl-2-pyridin-2-yl-5,6-dihydropyrimido[4,5-f]quinazoline is sourced from PubChem (CID 54032488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).