C28H57NO6 — CID 54032587
(2R,3R,4R,5S)-6-[3-methoxypropyl(octadec-9-enyl)amino]hexane-1,2,3,4,5-pentol (PubChem CID 54032587) has the molecular formula C28H57NO6 and a molecular weight of 503.77 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-[3-methoxypropyl(octadec-9-enyl)amino]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S)-6-[3-methoxypropyl(octadec-9-enyl)amino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 54032587 |
| Molecular Formula | C28H57NO6 |
| Molecular Weight | 503.77 g/mol |
| Exact Mass | 503.42 |
| IUPAC Name | (2R,3R,4R,5S)-6-[3-methoxypropyl(octadec-9-enyl)amino]hexane-1,2,3,4,5-pentol |
| SMILES | CCCCCCCCC=CCCCCCCCCN(CCCOC)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C28H57NO6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-29(21-19-22-35-2)23-25(31)27(33)28(34)26(32)24-30/h10-11,25-28,30-34H,3-9,12-24H2,1-2H3/t25-,26+,27+,28+/m0/s1 |
| InChIKey | LGQPTVVOCLQEOD-KUXCXQDQSA-N |
| XLogP | 3.80 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.77 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|