About N'-acetyl-2,2-difluoroacetohydrazide
N'-acetyl-2,2-difluoroacetohydrazide (PubChem CID 54033133) has the molecular formula C4H6F2N2O2
and a molecular weight of 152.10 g/mol. Its IUPAC name is N'-acetyl-2,2-difluoroacetohydrazide.
Molecular Properties
| Compound Name | N'-acetyl-2,2-difluoroacetohydrazide |
| PubChem CID | 54033133 |
| Molecular Formula | C4H6F2N2O2 |
| Molecular Weight | 152.10 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | N'-acetyl-2,2-difluoroacetohydrazide |
| SMILES | CC(=O)NNC(=O)C(F)F |
| InChI | InChI=1S/C4H6F2N2O2/c1-2(9)7-8-4(10)3(5)6/h3H,1H3,(H,7,9)(H,8,10) |
| InChIKey | PZCCGEYTFKHAOX-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.10 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-acetyl-2,2-difluoroacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-acetyl-2,2-difluoroacetohydrazide?
The IUPAC name of N'-acetyl-2,2-difluoroacetohydrazide (CID 54033133) is N'-acetyl-2,2-difluoroacetohydrazide.
What is the SMILES notation for N'-acetyl-2,2-difluoroacetohydrazide?
The canonical SMILES for N'-acetyl-2,2-difluoroacetohydrazide is CC(=O)NNC(=O)C(F)F.
What is the InChIKey of N'-acetyl-2,2-difluoroacetohydrazide?
The InChIKey is PZCCGEYTFKHAOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6F2N2O2/c1-2(9)7-8-4(10)3(5)6/h3H,1H3,(H,7,9)(H,8,10).
What are the key properties of N'-acetyl-2,2-difluoroacetohydrazide?
N'-acetyl-2,2-difluoroacetohydrazide has a molecular weight of 152.10 g/mol, XLogP of -0.58, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-acetyl-2,2-difluoroacetohydrazide is sourced from PubChem (CID 54033133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).