C28H6F12O8 — CID 54033498
14,14,18,18-tetrakis(trifluoromethyl)-4,9,23,28-tetraoxaheptacyclo[15.11.0.03,15.05,13.07,11.019,27.021,25]octacosa-1(17),2,5(13),6,11,15,19(27),20,25-nonaene-8,10,22,24-tetrone (PubChem CID 54033498) has the molecular formula C28H6F12O8 and a molecular weight of 698.32 g/mol. Its IUPAC name is 14,14,18,18-tetrakis(trifluoromethyl)-4,9,23,28-tetraoxaheptacyclo[15.11.0.03,15.05,13.07,11.019,27.021,25]octacosa-1(17),2,5(13),6,11,15,19(27),20,25-nonaene-8,10,22,24-tetrone.
| Compound Name | 14,14,18,18-tetrakis(trifluoromethyl)-4,9,23,28-tetraoxaheptacyclo[15.11.0.03,15.05,13.07,11.019,27.021,25]octacosa-1(17),2,5(13),6,11,15,19(27),20,25-nonaene-8,10,22,24-tetrone |
|---|---|
| PubChem CID | 54033498 |
| Molecular Formula | C28H6F12O8 |
| Molecular Weight | 698.32 g/mol |
| Exact Mass | 697.99 |
| IUPAC Name | 14,14,18,18-tetrakis(trifluoromethyl)-4,9,23,28-tetraoxaheptacyclo[15.11.0.03,15.05,13.07,11.019,27.021,25]octacosa-1(17),2,5(13),6,11,15,19(27),20,25-nonaene-8,10,22,24-tetrone |
| SMILES | O=C1OC(=O)c2cc3c(cc21)Oc1cc2c(cc1C3(C(F)(F)F)C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)c1cc3c(cc1O2)C(=O)OC3=O |
| InChI | InChI=1S/C28H6F12O8/c29-25(30,31)23(26(32,33)34)11-1-7-9(21(43)47-19(7)41)3-15(11)45-17-6-18-14(5-13(17)23)24(27(35,36)37,28(38,39)40)12-2-8-10(4-16(12)46-18)22(44)48-20(8)42/h1-6H |
| InChIKey | LHGXLJNHHUUBML-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.32 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|