C28H54O4Si — CID 54033834
7-[(1R,5R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloctyl]-5-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 54033834) has the molecular formula C28H54O4Si and a molecular weight of 482.82 g/mol. Its IUPAC name is 7-[(1R,5R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloctyl]-5-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,5R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloctyl]-5-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54033834 |
| Molecular Formula | C28H54O4Si |
| Molecular Weight | 482.82 g/mol |
| Exact Mass | 482.38 |
| IUPAC Name | 7-[(1R,5R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloctyl]-5-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC(C)(C)C(CCC1CC[C@@H](O)[C@@H]1CC=CCCCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H54O4Si/c1-9-10-21-28(5,6)25(32-33(7,8)27(2,3)4)20-18-22-17-19-24(29)23(22)15-13-11-12-14-16-26(30)31/h11,13,22-25,29H,9-10,12,14-21H2,1-8H3,(H,30,31)/t22?,23-,24-,25?/m1/s1 |
| InChIKey | LHNKYXLNHKXUSF-VHQZPVSYSA-N |
| XLogP | 7.96 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.82 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|