C29H31ClN3O8S3+ — CID 54033945
2-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)-N-methylsulfonylacetamide;[2-[(E)-2-ethoxybut-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]methanesulfonate (PubChem CID 54033945) has the molecular formula C29H31ClN3O8S3+ and a molecular weight of 681.23 g/mol. Its IUPAC name is 2-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)-N-methylsulfonylacetamide;[2-[(E)-2-ethoxybut-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]methanesulfonate.
| Compound Name | 2-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)-N-methylsulfonylacetamide;[2-[(E)-2-ethoxybut-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]methanesulfonate |
|---|---|
| PubChem CID | 54033945 |
| Molecular Formula | C29H31ClN3O8S3+ |
| Molecular Weight | 681.23 g/mol |
| Exact Mass | 680.10 |
| IUPAC Name | 2-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)-N-methylsulfonylacetamide;[2-[(E)-2-ethoxybut-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]methanesulfonate |
| SMILES | CCO/C(=C/c1oc2ccc3ccccc3c2[n+]1CS(=O)(=O)[O-])CC.Cc1sc2ccc(Cl)cc2[n+]1CC(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C18H19NO5S.C11H11ClN2O3S2/c1-3-14(23-4-2)11-17-19(12-25(20,21)22)18-15-8-6-5-7-13(15)9-10-16(18)24-17;1-7-14(6-11(15)13-19(2,16)17)9-5-8(12)3-4-10(9)18-7/h5-11H,3-4,12H2,1-2H3;3-5H,6H2,1-2H3/p+1/b14-11+; |
| InChIKey | XIONGOGMEWAKLM-JHGYPSGKSA-O |
| XLogP | 4.39 |
| TPSA | 150.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.23 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|