C8H7ClF5NO2 — CID 54033998
(2S)-1-(2,2,3,3,3-pentafluoropropanoyl)pyrrolidine-2-carbonyl chloride (PubChem CID 54033998) has the molecular formula C8H7ClF5NO2 and a molecular weight of 279.59 g/mol. Its IUPAC name is (2S)-1-(2,2,3,3,3-pentafluoropropanoyl)pyrrolidine-2-carbonyl chloride.
| Compound Name | (2S)-1-(2,2,3,3,3-pentafluoropropanoyl)pyrrolidine-2-carbonyl chloride |
|---|---|
| PubChem CID | 54033998 |
| Molecular Formula | C8H7ClF5NO2 |
| Molecular Weight | 279.59 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | (2S)-1-(2,2,3,3,3-pentafluoropropanoyl)pyrrolidine-2-carbonyl chloride |
| SMILES | O=C(Cl)[C@@H]1CCCN1C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H7ClF5NO2/c9-5(16)4-2-1-3-15(4)6(17)7(10,11)8(12,13)14/h4H,1-3H2/t4-/m0/s1 |
| InChIKey | LHPXTRMKQFQUED-BYPYZUCNSA-N |
| XLogP | 1.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.59 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|